C15H34O5Si3 — CID 91064241
(3R,4R,5R)-3-methyl-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-one (PubChem CID 91064241) has the molecular formula C15H34O5Si3 and a molecular weight of 378.69 g/mol. Its IUPAC name is (3R,4R,5R)-3-methyl-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-one.
| Compound Name | (3R,4R,5R)-3-methyl-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-one |
|---|---|
| PubChem CID | 91064241 |
| Molecular Formula | C15H34O5Si3 |
| Molecular Weight | 378.69 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | (3R,4R,5R)-3-methyl-3,4-bis(trimethylsilyloxy)-5-(trimethylsilyloxymethyl)oxolan-2-one |
| SMILES | C[C@]1(O[Si](C)(C)C)C(=O)O[C@H](CO[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C15H34O5Si3/c1-15(20-23(8,9)10)13(19-22(5,6)7)12(18-14(15)16)11-17-21(2,3)4/h12-13H,11H2,1-10H3/t12-,13-,15-/m1/s1 |
| InChIKey | KOEYIGNFJQAGJP-UMVBOHGHSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.69 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|