C30H64O7Si4 — CID 6430567
tris[tert-butyl(dimethyl)silyl] 1-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate (PubChem CID 6430567) has the molecular formula C30H64O7Si4 and a molecular weight of 649.18 g/mol. Its IUPAC name is tris[tert-butyl(dimethyl)silyl] 1-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate.
| Compound Name | tris[tert-butyl(dimethyl)silyl] 1-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate |
|---|---|
| PubChem CID | 6430567 |
| Molecular Formula | C30H64O7Si4 |
| Molecular Weight | 649.18 g/mol |
| Exact Mass | 648.37 |
| IUPAC Name | tris[tert-butyl(dimethyl)silyl] 1-[tert-butyl(dimethyl)silyl]oxypropane-1,2,3-tricarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)CC(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H64O7Si4/c1-27(2,3)38(13,14)34-23(31)21-22(25(32)36-40(17,18)29(7,8)9)24(35-39(15,16)28(4,5)6)26(33)37-41(19,20)30(10,11)12/h22,24H,21H2,1-20H3 |
| InChIKey | VTGQOGVLTQSXMO-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.18 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|