C15H36O4Si3 — CID 523315
trimethylsilyl 3-methyl-3,5-bis(trimethylsilyloxy)pentanoate (PubChem CID 523315) has the molecular formula C15H36O4Si3 and a molecular weight of 364.71 g/mol. Its IUPAC name is trimethylsilyl 3-methyl-3,5-bis(trimethylsilyloxy)pentanoate.
| Compound Name | trimethylsilyl 3-methyl-3,5-bis(trimethylsilyloxy)pentanoate |
|---|---|
| PubChem CID | 523315 |
| Molecular Formula | C15H36O4Si3 |
| Molecular Weight | 364.71 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | trimethylsilyl 3-methyl-3,5-bis(trimethylsilyloxy)pentanoate |
| SMILES | CC(CCO[Si](C)(C)C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H36O4Si3/c1-15(19-22(8,9)10,11-12-17-20(2,3)4)13-14(16)18-21(5,6)7/h11-13H2,1-10H3 |
| InChIKey | HUAKLDAFGDRXAP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.71 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|