C17H38O5Si3 — CID 552441
bis(trimethylsilyl) 2,3,4-trimethyl-3-trimethylsilyloxypentanedioate (PubChem CID 552441) has the molecular formula C17H38O5Si3 and a molecular weight of 406.74 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,3,4-trimethyl-3-trimethylsilyloxypentanedioate.
| Compound Name | bis(trimethylsilyl) 2,3,4-trimethyl-3-trimethylsilyloxypentanedioate |
|---|---|
| PubChem CID | 552441 |
| Molecular Formula | C17H38O5Si3 |
| Molecular Weight | 406.74 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | bis(trimethylsilyl) 2,3,4-trimethyl-3-trimethylsilyloxypentanedioate |
| SMILES | CC(C(=O)O[Si](C)(C)C)C(C)(O[Si](C)(C)C)C(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O5Si3/c1-13(15(18)20-23(4,5)6)17(3,22-25(10,11)12)14(2)16(19)21-24(7,8)9/h13-14H,1-12H3 |
| InChIKey | WUPQZCJWTFSXOB-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.74 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|