C16H36O5Si3 — CID 552447
bis(trimethylsilyl) 2,3-dimethyl-3-trimethylsilyloxypentanedioate (PubChem CID 552447) has the molecular formula C16H36O5Si3 and a molecular weight of 392.72 g/mol. Its IUPAC name is bis(trimethylsilyl) 2,3-dimethyl-3-trimethylsilyloxypentanedioate.
| Compound Name | bis(trimethylsilyl) 2,3-dimethyl-3-trimethylsilyloxypentanedioate |
|---|---|
| PubChem CID | 552447 |
| Molecular Formula | C16H36O5Si3 |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | bis(trimethylsilyl) 2,3-dimethyl-3-trimethylsilyloxypentanedioate |
| SMILES | CC(C(=O)O[Si](C)(C)C)C(C)(CC(=O)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O5Si3/c1-13(15(18)20-23(6,7)8)16(2,21-24(9,10)11)12-14(17)19-22(3,4)5/h13H,12H2,1-11H3 |
| InChIKey | DXCAYBXDJQBDFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|