C26H54O6Si3 — CID 91752642
bis[tert-butyl(dimethyl)silyl] 3-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2-methylpentanedioate (PubChem CID 91752642) has the molecular formula C26H54O6Si3 and a molecular weight of 546.97 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 3-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2-methylpentanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 3-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2-methylpentanedioate |
|---|---|
| PubChem CID | 91752642 |
| Molecular Formula | C26H54O6Si3 |
| Molecular Weight | 546.97 g/mol |
| Exact Mass | 546.32 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 3-[2-[tert-butyl(dimethyl)silyl]oxy-2-oxoethyl]-2-methylpentanedioate |
| SMILES | CC(C(=O)O[Si](C)(C)C(C)(C)C)C(CC(=O)O[Si](C)(C)C(C)(C)C)CC(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H54O6Si3/c1-19(23(29)32-35(15,16)26(8,9)10)20(17-21(27)30-33(11,12)24(2,3)4)18-22(28)31-34(13,14)25(5,6)7/h19-20H,17-18H2,1-16H3 |
| InChIKey | FIIBTZKDSXQOEQ-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.97 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|