C19H40O4Si2 — CID 91752558
bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpentanedioate (PubChem CID 91752558) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpentanedioate.
| Compound Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpentanedioate |
|---|---|
| PubChem CID | 91752558 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | bis[tert-butyl(dimethyl)silyl] 2,2-dimethylpentanedioate |
| SMILES | CC(C)(CCC(=O)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si2/c1-17(2,3)24(9,10)22-15(20)13-14-19(7,8)16(21)23-25(11,12)18(4,5)6/h13-14H2,1-12H3 |
| InChIKey | IQIXESCUEIPTRG-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|