C22H46O7Si2 — CID 59046597
1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 5-O-[2-(2-methoxyethoxy)ethyl] 2,2,4,4-tetramethylpentanedioate (PubChem CID 59046597) has the molecular formula C22H46O7Si2 and a molecular weight of 478.78 g/mol. Its IUPAC name is 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 5-O-[2-(2-methoxyethoxy)ethyl] 2,2,4,4-tetramethylpentanedioate.
| Compound Name | 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 5-O-[2-(2-methoxyethoxy)ethyl] 2,2,4,4-tetramethylpentanedioate |
|---|---|
| PubChem CID | 59046597 |
| Molecular Formula | C22H46O7Si2 |
| Molecular Weight | 478.78 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 1-O-[3-[dimethyl(trimethylsilyloxy)silyl]propyl] 5-O-[2-(2-methoxyethoxy)ethyl] 2,2,4,4-tetramethylpentanedioate |
| SMILES | COCCOCCOC(=O)C(C)(C)CC(C)(C)C(=O)OCCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H46O7Si2/c1-21(2,18-22(3,4)20(24)28-16-15-26-14-13-25-5)19(23)27-12-11-17-31(9,10)29-30(6,7)8/h11-18H2,1-10H3 |
| InChIKey | SNEDDQMAIDVRMU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.78 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|