C12H24O4Si — CID 10106693
methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate (PubChem CID 10106693) has the molecular formula C12H24O4Si and a molecular weight of 260.41 g/mol. Its IUPAC name is methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate.
| Compound Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
|---|---|
| PubChem CID | 10106693 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | methyl 3-[tert-butyl(dimethyl)silyl]oxy-5-oxopentanoate |
| SMILES | COC(=O)CC(CC=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O4Si/c1-12(2,3)17(5,6)16-10(7-8-13)9-11(14)15-4/h8,10H,7,9H2,1-6H3 |
| InChIKey | ZEPDOYUWXXKUHZ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|