C20H34ClNO2 — CID 10991894
4-carboxybutyl-[(3,5-ditert-butylphenyl)methyl]azanium chloride (PubChem CID 10991894) has the molecular formula C20H34ClNO2 and a molecular weight of 355.95 g/mol. Its IUPAC name is 4-carboxybutyl-[(3,5-ditert-butylphenyl)methyl]azanium chloride.
| Compound Name | 4-carboxybutyl-[(3,5-ditert-butylphenyl)methyl]azanium chloride |
|---|---|
| PubChem CID | 10991894 |
| Molecular Formula | C20H34ClNO2 |
| Molecular Weight | 355.95 g/mol |
| Exact Mass | 355.23 |
| IUPAC Name | 4-carboxybutyl-[(3,5-ditert-butylphenyl)methyl]azanium chloride |
| SMILES | CC(C)(C)c1cc(C[NH2+]CCCCC(=O)O)cc(C(C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C20H33NO2.ClH/c1-19(2,3)16-11-15(12-17(13-16)20(4,5)6)14-21-10-8-7-9-18(22)23;/h11-13,21H,7-10,14H2,1-6H3,(H,22,23);1H |
| InChIKey | MHNHPUHAGMKZGN-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 53.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.95 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|