C36H44NS+ — CID 102356996
(3,5-ditert-butylphenyl)methyl-(2-tritylsulfanylethyl)azanium (PubChem CID 102356996) has the molecular formula C36H44NS+ and a molecular weight of 522.82 g/mol. Its IUPAC name is (3,5-ditert-butylphenyl)methyl-(2-tritylsulfanylethyl)azanium.
| Compound Name | (3,5-ditert-butylphenyl)methyl-(2-tritylsulfanylethyl)azanium |
|---|---|
| PubChem CID | 102356996 |
| Molecular Formula | C36H44NS+ |
| Molecular Weight | 522.82 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | (3,5-ditert-butylphenyl)methyl-(2-tritylsulfanylethyl)azanium |
| SMILES | CC(C)(C)c1cc(C[NH2+]CCSC(c2ccccc2)(c2ccccc2)c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C36H43NS/c1-34(2,3)32-24-28(25-33(26-32)35(4,5)6)27-37-22-23-38-36(29-16-10-7-11-17-29,30-18-12-8-13-19-30)31-20-14-9-15-21-31/h7-21,24-26,37H,22-23,27H2,1-6H3/p+1 |
| InChIKey | FWTWTSOPNJTOFU-UHFFFAOYSA-O |
| XLogP | 8.07 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.82 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|