C29H37N — CID 145004307
N-[(3,5-ditert-butylphenyl)methyl]-1,2-diphenylethanamine (PubChem CID 145004307) has the molecular formula C29H37N and a molecular weight of 399.62 g/mol. Its IUPAC name is N-[(3,5-ditert-butylphenyl)methyl]-1,2-diphenylethanamine.
| Compound Name | N-[(3,5-ditert-butylphenyl)methyl]-1,2-diphenylethanamine |
|---|---|
| PubChem CID | 145004307 |
| Molecular Formula | C29H37N |
| Molecular Weight | 399.62 g/mol |
| Exact Mass | 399.29 |
| IUPAC Name | N-[(3,5-ditert-butylphenyl)methyl]-1,2-diphenylethanamine |
| SMILES | CC(C)(C)c1cc(CNC(Cc2ccccc2)c2ccccc2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H37N/c1-28(2,3)25-17-23(18-26(20-25)29(4,5)6)21-30-27(24-15-11-8-12-16-24)19-22-13-9-7-10-14-22/h7-18,20,27,30H,19,21H2,1-6H3 |
| InChIKey | DFYQZHILRKDUSA-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |