C21H22N2O — CID 94402617
4-[[[(1R)-1,2-diphenylethyl]amino]methyl]-1-methylpyridin-2-one (PubChem CID 94402617) has the molecular formula C21H22N2O and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[[(1R)-1,2-diphenylethyl]amino]methyl]-1-methylpyridin-2-one.
| Compound Name | 4-[[[(1R)-1,2-diphenylethyl]amino]methyl]-1-methylpyridin-2-one |
|---|---|
| PubChem CID | 94402617 |
| Molecular Formula | C21H22N2O |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | 4-[[[(1R)-1,2-diphenylethyl]amino]methyl]-1-methylpyridin-2-one |
| SMILES | Cn1ccc(CN[C@H](Cc2ccccc2)c2ccccc2)cc1=O |
| InChI | InChI=1S/C21H22N2O/c1-23-13-12-18(15-21(23)24)16-22-20(19-10-6-3-7-11-19)14-17-8-4-2-5-9-17/h2-13,15,20,22H,14,16H2,1H3/t20-/m1/s1 |
| InChIKey | DLVUXMUZYDZBHJ-HXUWFJFHSA-N |
| XLogP | 3.46 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |