C19H38O3S2 — CID 10992502
methyl 2-methoxy-13-methyl-6,7-bis(methylsulfanyl)tetradecanoate (PubChem CID 10992502) has the molecular formula C19H38O3S2 and a molecular weight of 378.64 g/mol. Its IUPAC name is methyl 2-methoxy-13-methyl-6,7-bis(methylsulfanyl)tetradecanoate.
| Compound Name | methyl 2-methoxy-13-methyl-6,7-bis(methylsulfanyl)tetradecanoate |
|---|---|
| PubChem CID | 10992502 |
| Molecular Formula | C19H38O3S2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | methyl 2-methoxy-13-methyl-6,7-bis(methylsulfanyl)tetradecanoate |
| SMILES | COC(=O)C(CCCC(SC)C(CCCCCC(C)C)SC)OC |
| InChI | InChI=1S/C19H38O3S2/c1-15(2)11-8-7-9-13-17(23-5)18(24-6)14-10-12-16(21-3)19(20)22-4/h15-18H,7-14H2,1-6H3 |
| InChIKey | SVGQXWQUROQOAF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|