C12H17BrN2O7 — CID 10992555
5-bromo-2-ethoxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidin-4-one (PubChem CID 10992555) has the molecular formula C12H17BrN2O7 and a molecular weight of 381.18 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidin-4-one.
| Compound Name | 5-bromo-2-ethoxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidin-4-one |
|---|---|
| PubChem CID | 10992555 |
| Molecular Formula | C12H17BrN2O7 |
| Molecular Weight | 381.18 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 5-bromo-2-ethoxy-1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]pyrimidin-4-one |
| SMILES | CCOc1nc(=O)c(Br)cn1[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H17BrN2O7/c1-2-21-12-14-10(20)5(13)3-15(12)11-9(19)8(18)7(17)6(4-16)22-11/h3,6-9,11,16-19H,2,4H2,1H3/t6-,7-,8+,9-,11-/m1/s1 |
| InChIKey | OGCWNXDUTMGAJK-ZBGLXGBJSA-N |
| XLogP | -1.62 |
| TPSA | 134.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.18 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |