C22H40B2O4 — CID 10992777
4,4,5,5-tetramethyl-2-[1-[(1R,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane (PubChem CID 10992777) has the molecular formula C22H40B2O4 and a molecular weight of 390.18 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1-[(1R,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1-[(1R,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 10992777 |
| Molecular Formula | C22H40B2O4 |
| Molecular Weight | 390.18 g/mol |
| Exact Mass | 390.31 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1-[(1R,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)[C@@H]1CCCCCC[C@@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H40B2O4/c1-16(23-25-19(2,3)20(4,5)26-23)17-14-12-10-11-13-15-18(17)24-27-21(6,7)22(8,9)28-24/h17-18H,1,10-15H2,2-9H3/t17-,18-/m0/s1 |
| InChIKey | XRNVOPPVHNBJES-ROUUACIJSA-N |
| XLogP | 5.61 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.18 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|