C23H42B2O4 — CID 134904472
4,4,5,5-tetramethyl-2-[1-[1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane (PubChem CID 134904472) has the molecular formula C23H42B2O4 and a molecular weight of 404.21 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1-[1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1-[1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 134904472 |
| Molecular Formula | C23H42B2O4 |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 404.33 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1-[1-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclooctyl]ethenyl]-1,3,2-dioxaborolane |
| SMILES | C=C(B1OC(C)(C)C(C)(C)O1)C1(C)CCCCCCC1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C23H42B2O4/c1-17(24-26-19(2,3)20(4,5)27-24)23(10)16-14-12-11-13-15-18(23)25-28-21(6,7)22(8,9)29-25/h18H,1,11-16H2,2-10H3 |
| InChIKey | OKRNRVKLSMEDPF-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|