C23H27NO8 — CID 10993964
trimethyl (3E)-4-[benzyl-[(E)-4-ethoxy-4-oxobut-2-enyl]amino]buta-1,3-diene-1,1,3-tricarboxylate (PubChem CID 10993964) has the molecular formula C23H27NO8 and a molecular weight of 445.47 g/mol. Its IUPAC name is trimethyl (3E)-4-[benzyl-[(E)-4-ethoxy-4-oxobut-2-enyl]amino]buta-1,3-diene-1,1,3-tricarboxylate.
| Compound Name | trimethyl (3E)-4-[benzyl-[(E)-4-ethoxy-4-oxobut-2-enyl]amino]buta-1,3-diene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 10993964 |
| Molecular Formula | C23H27NO8 |
| Molecular Weight | 445.47 g/mol |
| Exact Mass | 445.17 |
| IUPAC Name | trimethyl (3E)-4-[benzyl-[(E)-4-ethoxy-4-oxobut-2-enyl]amino]buta-1,3-diene-1,1,3-tricarboxylate |
| SMILES | CCOC(=O)/C=C/CN(/C=C(\C=C(C(=O)OC)C(=O)OC)C(=O)OC)Cc1ccccc1 |
| InChI | InChI=1S/C23H27NO8/c1-5-32-20(25)12-9-13-24(15-17-10-7-6-8-11-17)16-18(21(26)29-2)14-19(22(27)30-3)23(28)31-4/h6-12,14,16H,5,13,15H2,1-4H3/b12-9+,18-16+ |
| InChIKey | JVIQRODHHFMVOA-MLNSLSNSSA-N |
| XLogP | 1.94 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|