C20H25NO5 — CID 122367945
diethyl 2-[2-[benzyl-[(Z)-but-2-enyl]amino]-2-oxoethylidene]propanedioate (PubChem CID 122367945) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is diethyl 2-[2-[benzyl-[(Z)-but-2-enyl]amino]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[benzyl-[(Z)-but-2-enyl]amino]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 122367945 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | diethyl 2-[2-[benzyl-[(Z)-but-2-enyl]amino]-2-oxoethylidene]propanedioate |
| SMILES | C/C=C\CN(Cc1ccccc1)C(=O)C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C20H25NO5/c1-4-7-13-21(15-16-11-9-8-10-12-16)18(22)14-17(19(23)25-5-2)20(24)26-6-3/h4,7-12,14H,5-6,13,15H2,1-3H3/b7-4- |
| InChIKey | HFMMOJKCACVNEI-DAXSKMNVSA-N |
| XLogP | 2.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|