C24H33NO5 — CID 122394489
diethyl 2-[2-[benzyl(2-methylideneheptyl)amino]-2-oxoethylidene]propanedioate (PubChem CID 122394489) has the molecular formula C24H33NO5 and a molecular weight of 415.53 g/mol. Its IUPAC name is diethyl 2-[2-[benzyl(2-methylideneheptyl)amino]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[benzyl(2-methylideneheptyl)amino]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 122394489 |
| Molecular Formula | C24H33NO5 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | diethyl 2-[2-[benzyl(2-methylideneheptyl)amino]-2-oxoethylidene]propanedioate |
| SMILES | C=C(CCCCC)CN(Cc1ccccc1)C(=O)C=C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C24H33NO5/c1-5-8-10-13-19(4)17-25(18-20-14-11-9-12-15-20)22(26)16-21(23(27)29-6-2)24(28)30-7-3/h9,11-12,14-16H,4-8,10,13,17-18H2,1-3H3 |
| InChIKey | GCNRIDROMZISBT-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|