C25H36N2O5 — CID 177460249
diethyl 2-[2-[benzyl-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]amino]-2-oxoethylidene]propanedioate (PubChem CID 177460249) has the molecular formula C25H36N2O5 and a molecular weight of 444.57 g/mol. Its IUPAC name is diethyl 2-[2-[benzyl-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]amino]-2-oxoethylidene]propanedioate.
| Compound Name | diethyl 2-[2-[benzyl-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]amino]-2-oxoethylidene]propanedioate |
|---|---|
| PubChem CID | 177460249 |
| Molecular Formula | C25H36N2O5 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.26 |
| IUPAC Name | diethyl 2-[2-[benzyl-[2-[(2S,6R)-2,6-dimethylpiperidin-1-yl]ethyl]amino]-2-oxoethylidene]propanedioate |
| SMILES | CCOC(=O)C(=CC(=O)N(CCN1[C@H](C)CCC[C@@H]1C)Cc1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C25H36N2O5/c1-5-31-24(29)22(25(30)32-6-2)17-23(28)26(18-21-13-8-7-9-14-21)15-16-27-19(3)11-10-12-20(27)4/h7-9,13-14,17,19-20H,5-6,10-12,15-16,18H2,1-4H3/t19-,20+ |
| InChIKey | YTDPTDBNAONCMG-BGYRXZFFSA-N |
| XLogP | 3.33 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|