C28H33NO5 — CID 70029971
3-[4-[2-[benzyl-(2-ethoxy-2-oxoacetyl)amino]-1-cyclohexylethyl]phenyl]prop-2-enoic acid (PubChem CID 70029971) has the molecular formula C28H33NO5 and a molecular weight of 463.57 g/mol. Its IUPAC name is 3-[4-[2-[benzyl-(2-ethoxy-2-oxoacetyl)amino]-1-cyclohexylethyl]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[2-[benzyl-(2-ethoxy-2-oxoacetyl)amino]-1-cyclohexylethyl]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70029971 |
| Molecular Formula | C28H33NO5 |
| Molecular Weight | 463.57 g/mol |
| Exact Mass | 463.24 |
| IUPAC Name | 3-[4-[2-[benzyl-(2-ethoxy-2-oxoacetyl)amino]-1-cyclohexylethyl]phenyl]prop-2-enoic acid |
| SMILES | CCOC(=O)C(=O)N(Cc1ccccc1)CC(c1ccc(C=CC(=O)O)cc1)C1CCCCC1 |
| InChI | InChI=1S/C28H33NO5/c1-2-34-28(33)27(32)29(19-22-9-5-3-6-10-22)20-25(23-11-7-4-8-12-23)24-16-13-21(14-17-24)15-18-26(30)31/h3,5-6,9-10,13-18,23,25H,2,4,7-8,11-12,19-20H2,1H3,(H,30,31) |
| InChIKey | FURNIFXZKINOGG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|