C38H38N2O5 — CID 70028405
2-[benzyl-[2-cyclohexyl-2-[4-[3-oxo-3-(4-phenoxyanilino)prop-1-enyl]phenyl]ethyl]amino]-2-oxoacetic acid (PubChem CID 70028405) has the molecular formula C38H38N2O5 and a molecular weight of 602.73 g/mol. Its IUPAC name is 2-[benzyl-[2-cyclohexyl-2-[4-[3-oxo-3-(4-phenoxyanilino)prop-1-enyl]phenyl]ethyl]amino]-2-oxoacetic acid.
| Compound Name | 2-[benzyl-[2-cyclohexyl-2-[4-[3-oxo-3-(4-phenoxyanilino)prop-1-enyl]phenyl]ethyl]amino]-2-oxoacetic acid |
|---|---|
| PubChem CID | 70028405 |
| Molecular Formula | C38H38N2O5 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | 2-[benzyl-[2-cyclohexyl-2-[4-[3-oxo-3-(4-phenoxyanilino)prop-1-enyl]phenyl]ethyl]amino]-2-oxoacetic acid |
| SMILES | O=C(C=Cc1ccc(C(CN(Cc2ccccc2)C(=O)C(=O)O)C2CCCCC2)cc1)Nc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C38H38N2O5/c41-36(39-32-21-23-34(24-22-32)45-33-14-8-3-9-15-33)25-18-28-16-19-31(20-17-28)35(30-12-6-2-7-13-30)27-40(37(42)38(43)44)26-29-10-4-1-5-11-29/h1,3-5,8-11,14-25,30,35H,2,6-7,12-13,26-27H2,(H,39,41)(H,43,44) |
| InChIKey | PEYOCUMDPIHPCC-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|