C28H24O6 — CID 10994121
(1S,2S,7R,8R)-7,8-dihydroxy-4,11-bis[(E)-2-(4-methylphenyl)ethenyl]-3,12-dioxatricyclo[6.4.0.02,7]dodeca-4,10-diene-6,9-dione (PubChem CID 10994121) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is (1S,2S,7R,8R)-7,8-dihydroxy-4,11-bis[(E)-2-(4-methylphenyl)ethenyl]-3,12-dioxatricyclo[6.4.0.02,7]dodeca-4,10-diene-6,9-dione.
| Compound Name | (1S,2S,7R,8R)-7,8-dihydroxy-4,11-bis[(E)-2-(4-methylphenyl)ethenyl]-3,12-dioxatricyclo[6.4.0.02,7]dodeca-4,10-diene-6,9-dione |
|---|---|
| PubChem CID | 10994121 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | (1S,2S,7R,8R)-7,8-dihydroxy-4,11-bis[(E)-2-(4-methylphenyl)ethenyl]-3,12-dioxatricyclo[6.4.0.02,7]dodeca-4,10-diene-6,9-dione |
| SMILES | Cc1ccc(/C=C/C2=CC(=O)[C@@]3(O)[C@@H](O2)[C@@H]2OC(/C=C/c4ccc(C)cc4)=CC(=O)[C@@]23O)cc1 |
| InChI | InChI=1S/C28H24O6/c1-17-3-7-19(8-4-17)11-13-21-15-23(29)27(31)25(33-21)26-28(27,32)24(30)16-22(34-26)14-12-20-9-5-18(2)6-10-20/h3-16,25-26,31-32H,1-2H3/b13-11+,14-12+/t25-,26-,27+,28+/m0/s1 |
| InChIKey | XBSMQFSQBIOVAG-ZXFCHADASA-N |
| XLogP | 3.21 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |