C29H58O8Si — CID 10995322
methyl (E,4R,5R,6R,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,6-bis(methoxymethoxy)octadec-2-enoate (PubChem CID 10995322) has the molecular formula C29H58O8Si and a molecular weight of 562.86 g/mol. Its IUPAC name is methyl (E,4R,5R,6R,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,6-bis(methoxymethoxy)octadec-2-enoate.
| Compound Name | methyl (E,4R,5R,6R,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,6-bis(methoxymethoxy)octadec-2-enoate |
|---|---|
| PubChem CID | 10995322 |
| Molecular Formula | C29H58O8Si |
| Molecular Weight | 562.86 g/mol |
| Exact Mass | 562.39 |
| IUPAC Name | methyl (E,4R,5R,6R,17S)-17-[tert-butyl(dimethyl)silyl]oxy-4-hydroxy-5,6-bis(methoxymethoxy)octadec-2-enoate |
| SMILES | COCO[C@H]([C@H](O)/C=C/C(=O)OC)[C@@H](CCCCCCCCCC[C@H](C)O[Si](C)(C)C(C)(C)C)OCOC |
| InChI | InChI=1S/C29H58O8Si/c1-24(37-38(8,9)29(2,3)4)18-16-14-12-10-11-13-15-17-19-26(35-22-32-5)28(36-23-33-6)25(30)20-21-27(31)34-7/h20-21,24-26,28,30H,10-19,22-23H2,1-9H3/b21-20+/t24-,25+,26+,28+/m0/s1 |
| InChIKey | DIQQMXCCSOINGX-BWZYGZIVSA-N |
| XLogP | 6.37 |
| TPSA | 92.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.86 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|