C9H18O2 — CID 10997318
[(2S,3S)-3-(4-methylpentyl)oxiran-2-yl]methanol (PubChem CID 10997318) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is [(2S,3S)-3-(4-methylpentyl)oxiran-2-yl]methanol.
| Compound Name | [(2S,3S)-3-(4-methylpentyl)oxiran-2-yl]methanol |
|---|---|
| PubChem CID | 10997318 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | [(2S,3S)-3-(4-methylpentyl)oxiran-2-yl]methanol |
| SMILES | CC(C)CCC[C@@H]1O[C@H]1CO |
| InChI | InChI=1S/C9H18O2/c1-7(2)4-3-5-8-9(6-10)11-8/h7-10H,3-6H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | AXHKYUHDICERSD-IUCAKERBSA-N |
| XLogP | 1.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|