C11H22O3Si — CID 10998822
(2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuran-3-ol (PubChem CID 10998822) has the molecular formula C11H22O3Si and a molecular weight of 230.38 g/mol. Its IUPAC name is (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuran-3-ol.
| Compound Name | (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuran-3-ol |
|---|---|
| PubChem CID | 10998822 |
| Molecular Formula | C11H22O3Si |
| Molecular Weight | 230.38 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | (2R,3S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-2,3-dihydrofuran-3-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC=C[C@@H]1O |
| InChI | InChI=1S/C11H22O3Si/c1-11(2,3)15(4,5)14-8-10-9(12)6-7-13-10/h6-7,9-10,12H,8H2,1-5H3/t9-,10+/m0/s1 |
| InChIKey | UHHRNZMLENNIIS-VHSXEESVSA-N |
| XLogP | 2.28 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.38 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|