C11H24O2Si2 — CID 14185814
(E,1R)-3-trimethylsilyl-1-[(2R,3R)-3-trimethylsilyloxiran-2-yl]prop-2-en-1-ol (PubChem CID 14185814) has the molecular formula C11H24O2Si2 and a molecular weight of 244.48 g/mol. Its IUPAC name is (E,1R)-3-trimethylsilyl-1-[(2R,3R)-3-trimethylsilyloxiran-2-yl]prop-2-en-1-ol.
| Compound Name | (E,1R)-3-trimethylsilyl-1-[(2R,3R)-3-trimethylsilyloxiran-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 14185814 |
| Molecular Formula | C11H24O2Si2 |
| Molecular Weight | 244.48 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (E,1R)-3-trimethylsilyl-1-[(2R,3R)-3-trimethylsilyloxiran-2-yl]prop-2-en-1-ol |
| SMILES | C[Si](C)(C)/C=C/[C@@H](O)[C@H]1O[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C11H24O2Si2/c1-14(2,3)8-7-9(12)10-11(13-10)15(4,5)6/h7-12H,1-6H3/b8-7+/t9-,10-,11-/m1/s1 |
| InChIKey | DXIPMMUCJOMNEY-QMVIJHPZSA-N |
| XLogP | 2.43 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|