C11H22O2Si — CID 138981692
(Z,1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hex-3-en-1-ol (PubChem CID 138981692) has the molecular formula C11H22O2Si and a molecular weight of 214.38 g/mol. Its IUPAC name is (Z,1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hex-3-en-1-ol.
| Compound Name | (Z,1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hex-3-en-1-ol |
|---|---|
| PubChem CID | 138981692 |
| Molecular Formula | C11H22O2Si |
| Molecular Weight | 214.38 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | (Z,1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]hex-3-en-1-ol |
| SMILES | CC/C=C\C[C@H](O)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C11H22O2Si/c1-5-6-7-8-9(12)10-11(13-10)14(2,3)4/h6-7,9-12H,5,8H2,1-4H3/b7-6-/t9-,10-,11-/m0/s1 |
| InChIKey | ROCOZEVRNTYZJL-ILZRGQEZSA-N |
| XLogP | 2.35 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.38 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|