C14H26O2Si — CID 138982240
(1S,3Z,6Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]nona-3,6-dien-1-ol (PubChem CID 138982240) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (1S,3Z,6Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]nona-3,6-dien-1-ol.
| Compound Name | (1S,3Z,6Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]nona-3,6-dien-1-ol |
|---|---|
| PubChem CID | 138982240 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (1S,3Z,6Z)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]nona-3,6-dien-1-ol |
| SMILES | CC/C=C\C/C=C\C[C@H](O)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C14H26O2Si/c1-5-6-7-8-9-10-11-12(15)13-14(16-13)17(2,3)4/h6-7,9-10,12-15H,5,8,11H2,1-4H3/b7-6-,10-9-/t12-,13-,14-/m0/s1 |
| InChIKey | QEWBGDIYQUZAMU-GPOIZFMISA-N |
| XLogP | 3.29 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|