C9H18O2Si — CID 11106071
(1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]but-3-en-1-ol (PubChem CID 11106071) has the molecular formula C9H18O2Si and a molecular weight of 186.33 g/mol. Its IUPAC name is (1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]but-3-en-1-ol.
| Compound Name | (1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 11106071 |
| Molecular Formula | C9H18O2Si |
| Molecular Weight | 186.33 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (1S)-1-[(2S,3S)-3-trimethylsilyloxiran-2-yl]but-3-en-1-ol |
| SMILES | C=CC[C@H](O)[C@@H]1O[C@H]1[Si](C)(C)C |
| InChI | InChI=1S/C9H18O2Si/c1-5-6-7(10)8-9(11-8)12(2,3)4/h5,7-10H,1,6H2,2-4H3/t7-,8-,9-/m0/s1 |
| InChIKey | QFZPFIRYYKFDRH-CIUDSAMLSA-N |
| XLogP | 1.57 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.33 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|