C16H38O4Si2 — CID 158950519
trimethyl-[3-(oxiran-2-yl)prop-1-enyl]silane;5-trimethylsilylpentane-1,2-diol;hydrate (PubChem CID 158950519) has the molecular formula C16H38O4Si2 and a molecular weight of 350.65 g/mol. Its IUPAC name is trimethyl-[3-(oxiran-2-yl)prop-1-enyl]silane;5-trimethylsilylpentane-1,2-diol;hydrate.
| Compound Name | trimethyl-[3-(oxiran-2-yl)prop-1-enyl]silane;5-trimethylsilylpentane-1,2-diol;hydrate |
|---|---|
| PubChem CID | 158950519 |
| Molecular Formula | C16H38O4Si2 |
| Molecular Weight | 350.65 g/mol |
| Exact Mass | 350.23 |
| IUPAC Name | trimethyl-[3-(oxiran-2-yl)prop-1-enyl]silane;5-trimethylsilylpentane-1,2-diol;hydrate |
| SMILES | C[Si](C)(C)C=CCC1CO1.C[Si](C)(C)CCCC(O)CO.O |
| InChI | InChI=1S/C8H20O2Si.C8H16OSi.H2O/c1-11(2,3)6-4-5-8(10)7-9;1-10(2,3)6-4-5-8-7-9-8;/h8-10H,4-7H2,1-3H3;4,6,8H,5,7H2,1-3H3;1H2 |
| InChIKey | PNXYUPFVNUVGMD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 84.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.65 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|