C14H26O3 — CID 10999202
(2S,3R)-5-butoxy-2-pentyloxolane-3-carbaldehyde (PubChem CID 10999202) has the molecular formula C14H26O3 and a molecular weight of 242.36 g/mol. Its IUPAC name is (2S,3R)-5-butoxy-2-pentyloxolane-3-carbaldehyde.
| Compound Name | (2S,3R)-5-butoxy-2-pentyloxolane-3-carbaldehyde |
|---|---|
| PubChem CID | 10999202 |
| Molecular Formula | C14H26O3 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.19 |
| IUPAC Name | (2S,3R)-5-butoxy-2-pentyloxolane-3-carbaldehyde |
| SMILES | CCCCC[C@@H]1OC(OCCCC)C[C@H]1C=O |
| InChI | InChI=1S/C14H26O3/c1-3-5-7-8-13-12(11-15)10-14(17-13)16-9-6-4-2/h11-14H,3-10H2,1-2H3/t12-,13-,14?/m0/s1 |
| InChIKey | GQTGACBOVIBYNM-RFHHWMCGSA-N |
| XLogP | 3.31 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|