C13H26O3 — CID 139263532
(2S,3S)-2-butyl-3-(methoxymethoxy)heptanal (PubChem CID 139263532) has the molecular formula C13H26O3 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2S,3S)-2-butyl-3-(methoxymethoxy)heptanal.
| Compound Name | (2S,3S)-2-butyl-3-(methoxymethoxy)heptanal |
|---|---|
| PubChem CID | 139263532 |
| Molecular Formula | C13H26O3 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | (2S,3S)-2-butyl-3-(methoxymethoxy)heptanal |
| SMILES | CCCC[C@H](OCOC)[C@@H](C=O)CCCC |
| InChI | InChI=1S/C13H26O3/c1-4-6-8-12(10-14)13(9-7-5-2)16-11-15-3/h10,12-13H,4-9,11H2,1-3H3/t12-,13+/m1/s1 |
| InChIKey | UAZAQULPXPZHDE-OLZOCXBDSA-N |
| XLogP | 3.17 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|