C15H26O4 — CID 11000124
[(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enyl] acetate (PubChem CID 11000124) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enyl] acetate.
| Compound Name | [(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enyl] acetate |
|---|---|
| PubChem CID | 11000124 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [(E)-3-methyl-5-[(4R)-2,2,5,5-tetramethyl-1,3-dioxolan-4-yl]pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\C)CC[C@H]1OC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H26O4/c1-11(9-10-17-12(2)16)7-8-13-14(3,4)19-15(5,6)18-13/h9,13H,7-8,10H2,1-6H3/b11-9+/t13-/m1/s1 |
| InChIKey | GVGSIRPIWORMPB-YGNAEDSMSA-N |
| XLogP | 3.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|