C12H18O4 — CID 135017518
[(5R,7R)-2,2,9-trimethyl-1,3-dioxaspiro[4.4]non-8-en-7-yl] acetate (PubChem CID 135017518) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is [(5R,7R)-2,2,9-trimethyl-1,3-dioxaspiro[4.4]non-8-en-7-yl] acetate.
| Compound Name | [(5R,7R)-2,2,9-trimethyl-1,3-dioxaspiro[4.4]non-8-en-7-yl] acetate |
|---|---|
| PubChem CID | 135017518 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | [(5R,7R)-2,2,9-trimethyl-1,3-dioxaspiro[4.4]non-8-en-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1C=C(C)[C@@]2(COC(C)(C)O2)C1 |
| InChI | InChI=1S/C12H18O4/c1-8-5-10(15-9(2)13)6-12(8)7-14-11(3,4)16-12/h5,10H,6-7H2,1-4H3/t10-,12-/m0/s1 |
| InChIKey | RWBRSHSGPKZBEJ-JQWIXIFHSA-N |
| XLogP | 1.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|