C13H20O4 — CID 102386260
[(5R,7S,10S)-7,9-dimethyl-1,6-dioxaspiro[4.5]dec-8-en-10-yl]methyl acetate (PubChem CID 102386260) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is [(5R,7S,10S)-7,9-dimethyl-1,6-dioxaspiro[4.5]dec-8-en-10-yl]methyl acetate.
| Compound Name | [(5R,7S,10S)-7,9-dimethyl-1,6-dioxaspiro[4.5]dec-8-en-10-yl]methyl acetate |
|---|---|
| PubChem CID | 102386260 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | [(5R,7S,10S)-7,9-dimethyl-1,6-dioxaspiro[4.5]dec-8-en-10-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1C(C)=C[C@H](C)O[C@]12CCCO2 |
| InChI | InChI=1S/C13H20O4/c1-9-7-10(2)17-13(5-4-6-16-13)12(9)8-15-11(3)14/h7,10,12H,4-6,8H2,1-3H3/t10-,12+,13+/m0/s1 |
| InChIKey | FWXNEZLUMBCXQR-CYZMBNFOSA-N |
| XLogP | 2.04 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|