C20H26O8 — CID 135012892
[(2S)-6,7-bis(methoxycarbonyloxymethyl)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]octa-3,6-dienyl] acetate (PubChem CID 135012892) has the molecular formula C20H26O8 and a molecular weight of 394.42 g/mol. Its IUPAC name is [(2S)-6,7-bis(methoxycarbonyloxymethyl)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]octa-3,6-dienyl] acetate.
| Compound Name | [(2S)-6,7-bis(methoxycarbonyloxymethyl)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]octa-3,6-dienyl] acetate |
|---|---|
| PubChem CID | 135012892 |
| Molecular Formula | C20H26O8 |
| Molecular Weight | 394.42 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | [(2S)-6,7-bis(methoxycarbonyloxymethyl)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]octa-3,6-dienyl] acetate |
| SMILES | COC(=O)OCC1=C(COC(=O)OC)C2CC1C=C(C=C(C)C)[C@H]2OC(C)=O |
| InChI | InChI=1S/C20H26O8/c1-11(2)6-14-7-13-8-15(18(14)28-12(3)21)17(10-27-20(23)25-5)16(13)9-26-19(22)24-4/h6-7,13,15,18H,8-10H2,1-5H3/t13?,15?,18-/m1/s1 |
| InChIKey | QDQLULGOXRUAPY-LEHRNKBSSA-N |
| XLogP | 3.32 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.42 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|