C14H20O2 — CID 135038330
[(2S)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]oct-3-enyl] acetate (PubChem CID 135038330) has the molecular formula C14H20O2 and a molecular weight of 220.31 g/mol. Its IUPAC name is [(2S)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]oct-3-enyl] acetate.
| Compound Name | [(2S)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]oct-3-enyl] acetate |
|---|---|
| PubChem CID | 135038330 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | [(2S)-3-(2-methylprop-1-enyl)-2-bicyclo[3.2.1]oct-3-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1C(C=C(C)C)=CC2CCC1C2 |
| InChI | InChI=1S/C14H20O2/c1-9(2)6-13-8-11-4-5-12(7-11)14(13)16-10(3)15/h6,8,11-12,14H,4-5,7H2,1-3H3/t11?,12?,14-/m0/s1 |
| InChIKey | IKUDITXLLVHFEN-YIZWMMSDSA-N |
| XLogP | 3.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |