C20H26O6 — CID 135012891
[(2S)-2-acetyloxy-7-(acetyloxymethyl)-3-(2-methylprop-1-enyl)-6-bicyclo[3.2.1]octa-3,6-dienyl]methyl acetate (PubChem CID 135012891) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [(2S)-2-acetyloxy-7-(acetyloxymethyl)-3-(2-methylprop-1-enyl)-6-bicyclo[3.2.1]octa-3,6-dienyl]methyl acetate.
| Compound Name | [(2S)-2-acetyloxy-7-(acetyloxymethyl)-3-(2-methylprop-1-enyl)-6-bicyclo[3.2.1]octa-3,6-dienyl]methyl acetate |
|---|---|
| PubChem CID | 135012891 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [(2S)-2-acetyloxy-7-(acetyloxymethyl)-3-(2-methylprop-1-enyl)-6-bicyclo[3.2.1]octa-3,6-dienyl]methyl acetate |
| SMILES | CC(=O)OCC1=C(COC(C)=O)C2CC1C=C(C=C(C)C)[C@H]2OC(C)=O |
| InChI | InChI=1S/C20H26O6/c1-11(2)6-16-7-15-8-17(20(16)26-14(5)23)19(10-25-13(4)22)18(15)9-24-12(3)21/h6-7,15,17,20H,8-10H2,1-5H3/t15?,17?,20-/m1/s1 |
| InChIKey | LBSAYBZWZCKKLQ-MKJPBZQASA-N |
| XLogP | 2.88 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|