C24H36O4 — CID 14336525
[(1R,4E,6Z,8S,10E)-8-acetyloxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-yl] acetate (PubChem CID 14336525) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is [(1R,4E,6Z,8S,10E)-8-acetyloxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-yl] acetate.
| Compound Name | [(1R,4E,6Z,8S,10E)-8-acetyloxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-yl] acetate |
|---|---|
| PubChem CID | 14336525 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | [(1R,4E,6Z,8S,10E)-8-acetyloxy-4,10-dimethyl-14-methylidene-7-propan-2-ylcyclotetradeca-4,6,10-trien-1-yl] acetate |
| SMILES | C=C1CC/C=C(\C)C[C@H](OC(C)=O)/C(C(C)C)=C\C=C(/C)CC[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H36O4/c1-16(2)22-13-11-17(3)12-14-23(27-20(6)25)19(5)10-8-9-18(4)15-24(22)28-21(7)26/h9,11,13,16,23-24H,5,8,10,12,14-15H2,1-4,6-7H3/b17-11+,18-9+,22-13-/t23-,24+/m1/s1 |
| InChIKey | YNZHDHOLDNJBTI-BFXQDGBSSA-N |
| XLogP | 5.85 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|