C11H16HgO3 — CID 134981569
acetyloxy-[(1R,2S,5R,6R)-2-methoxy-6-bicyclo[3.2.1]oct-3-enyl]mercury (PubChem CID 134981569) has the molecular formula C11H16HgO3 and a molecular weight of 396.84 g/mol. Its IUPAC name is acetyloxy-[(1R,2S,5R,6R)-2-methoxy-6-bicyclo[3.2.1]oct-3-enyl]mercury.
| Compound Name | acetyloxy-[(1R,2S,5R,6R)-2-methoxy-6-bicyclo[3.2.1]oct-3-enyl]mercury |
|---|---|
| PubChem CID | 134981569 |
| Molecular Formula | C11H16HgO3 |
| Molecular Weight | 396.84 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | acetyloxy-[(1R,2S,5R,6R)-2-methoxy-6-bicyclo[3.2.1]oct-3-enyl]mercury |
| SMILES | CO[C@@H]1C=C[C@H]2C[C@@H]1C[C@H]2[Hg]OC(C)=O |
| InChI | InChI=1S/C9H13O.C2H4O2.Hg/c1-10-9-5-3-7-2-4-8(9)6-7;1-2(3)4;/h2-3,5,7-9H,4,6H2,1H3;1H3,(H,3,4);/q;;+1/p-1/t7-,8-,9+;;/m0../s1 |
| InChIKey | VLDVAFKOFYRWBA-DXDZSCKISA-M |
| XLogP | 1.95 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.84 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|