C17H22N2O3 — CID 110002043
N-(1-hydroxy-3-methylpentan-3-yl)-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide (PubChem CID 110002043) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-3-yl)-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 110002043 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-3-yl)-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)NC(C)(CC)CCO |
| InChI | InChI=1S/C17H22N2O3/c1-4-17(3,9-10-20)18-15(21)11-19-12(2)13-7-5-6-8-14(13)16(19)22/h5-8,20H,2,4,9-11H2,1,3H3,(H,18,21) |
| InChIKey | UQDPTMQGPFCANG-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |