C20H19N3O3 — CID 55802247
N-ethyl-4-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]benzamide (PubChem CID 55802247) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-ethyl-4-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]benzamide.
| Compound Name | N-ethyl-4-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 55802247 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-ethyl-4-[[2-(1-methylidene-3-oxoisoindol-2-yl)acetyl]amino]benzamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(C(=O)NCC)cc1 |
| InChI | InChI=1S/C20H19N3O3/c1-3-21-19(25)14-8-10-15(11-9-14)22-18(24)12-23-13(2)16-6-4-5-7-17(16)20(23)26/h4-11H,2-3,12H2,1H3,(H,21,25)(H,22,24) |
| InChIKey | VPQLCYKACXYZSY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |