C19H19N3O4S — CID 55960851
N-[4-(ethylsulfonylamino)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide (PubChem CID 55960851) has the molecular formula C19H19N3O4S and a molecular weight of 385.45 g/mol. Its IUPAC name is N-[4-(ethylsulfonylamino)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide.
| Compound Name | N-[4-(ethylsulfonylamino)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
|---|---|
| PubChem CID | 55960851 |
| Molecular Formula | C19H19N3O4S |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | N-[4-(ethylsulfonylamino)phenyl]-2-(1-methylidene-3-oxoisoindol-2-yl)acetamide |
| SMILES | C=C1c2ccccc2C(=O)N1CC(=O)Nc1ccc(NS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C19H19N3O4S/c1-3-27(25,26)21-15-10-8-14(9-11-15)20-18(23)12-22-13(2)16-6-4-5-7-17(16)19(22)24/h4-11,21H,2-3,12H2,1H3,(H,20,23) |
| InChIKey | CNGPRKRDBMJXCF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |