C14H26O3S — CID 11000264
(3R,5R)-3-[(1R)-1-hydroxyoctyl]-5-methyl-3-methylsulfanyloxolan-2-one (PubChem CID 11000264) has the molecular formula C14H26O3S and a molecular weight of 274.43 g/mol. Its IUPAC name is (3R,5R)-3-[(1R)-1-hydroxyoctyl]-5-methyl-3-methylsulfanyloxolan-2-one.
| Compound Name | (3R,5R)-3-[(1R)-1-hydroxyoctyl]-5-methyl-3-methylsulfanyloxolan-2-one |
|---|---|
| PubChem CID | 11000264 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | (3R,5R)-3-[(1R)-1-hydroxyoctyl]-5-methyl-3-methylsulfanyloxolan-2-one |
| SMILES | CCCCCCC[C@@H](O)[C@]1(SC)C[C@@H](C)OC1=O |
| InChI | InChI=1S/C14H26O3S/c1-4-5-6-7-8-9-12(15)14(18-3)10-11(2)17-13(14)16/h11-12,15H,4-10H2,1-3H3/t11-,12-,14-/m1/s1 |
| InChIKey | VDDOWQQCWKOHPU-YRGRVCCFSA-N |
| XLogP | 3.14 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|