C18H16O3 — CID 11000447
methyl (1aR,2S,3R,7bS)-3-phenyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene-2-carboxylate (PubChem CID 11000447) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl (1aR,2S,3R,7bS)-3-phenyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene-2-carboxylate.
| Compound Name | methyl (1aR,2S,3R,7bS)-3-phenyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene-2-carboxylate |
|---|---|
| PubChem CID | 11000447 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | methyl (1aR,2S,3R,7bS)-3-phenyl-1a,2,3,7b-tetrahydronaphtho[1,2-b]oxirene-2-carboxylate |
| SMILES | COC(=O)[C@H]1[C@H](c2ccccc2)c2ccccc2[C@@H]2O[C@H]12 |
| InChI | InChI=1S/C18H16O3/c1-20-18(19)15-14(11-7-3-2-4-8-11)12-9-5-6-10-13(12)16-17(15)21-16/h2-10,14-17H,1H3/t14-,15+,16+,17-/m1/s1 |
| InChIKey | CDODIJGSWWQGRO-LTIDMASMSA-N |
| XLogP | 3.06 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|