C16H22ClNO3 — CID 110004493
N-[1-(4-chlorophenyl)-2-hydroxyethyl]-2,6-dimethyloxane-4-carboxamide (PubChem CID 110004493) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-hydroxyethyl]-2,6-dimethyloxane-4-carboxamide.
| Compound Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-2,6-dimethyloxane-4-carboxamide |
|---|---|
| PubChem CID | 110004493 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-hydroxyethyl]-2,6-dimethyloxane-4-carboxamide |
| SMILES | CC1CC(C(=O)NC(CO)c2ccc(Cl)cc2)CC(C)O1 |
| InChI | InChI=1S/C16H22ClNO3/c1-10-7-13(8-11(2)21-10)16(20)18-15(9-19)12-3-5-14(17)6-4-12/h3-6,10-11,13,15,19H,7-9H2,1-2H3,(H,18,20) |
| InChIKey | MQKRLHVZBODCLL-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |