About [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol
[4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol (PubChem CID 110007069) has the molecular formula C12H12ClNOS2
and a molecular weight of 285.82 g/mol. Its IUPAC name is [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol.
Molecular Properties
| Compound Name | [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol |
| PubChem CID | 110007069 |
| Molecular Formula | C12H12ClNOS2 |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol |
| SMILES | OCc1ccc(CSCc2cnc(Cl)s2)cc1 |
| InChI | InChI=1S/C12H12ClNOS2/c13-12-14-5-11(17-12)8-16-7-10-3-1-9(6-15)2-4-10/h1-5,15H,6-8H2 |
| InChIKey | NTEVIDWVDMAJPE-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol?
The IUPAC name of [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol (CID 110007069) is [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol.
What is the SMILES notation for [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol?
The canonical SMILES for [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol is OCc1ccc(CSCc2cnc(Cl)s2)cc1.
What is the InChIKey of [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol?
The InChIKey is NTEVIDWVDMAJPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClNOS2/c13-12-14-5-11(17-12)8-16-7-10-3-1-9(6-15)2-4-10/h1-5,15H,6-8H2.
What are the key properties of [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol?
[4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol has a molecular weight of 285.82 g/mol, XLogP of 3.72, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[(2-chloro-1,3-thiazol-5-yl)methylsulfanylmethyl]phenyl]methanol is sourced from PubChem (CID 110007069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).