C14H15FN2O3 — CID 110007435
(E)-N-(4-fluorophenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobut-2-enamide (PubChem CID 110007435) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is (E)-N-(4-fluorophenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobut-2-enamide.
| Compound Name | (E)-N-(4-fluorophenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobut-2-enamide |
|---|---|
| PubChem CID | 110007435 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (E)-N-(4-fluorophenyl)-4-[(3S)-3-hydroxypyrrolidin-1-yl]-4-oxobut-2-enamide |
| SMILES | O=C(/C=C/C(=O)N1CC[C@H](O)C1)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN2O3/c15-10-1-3-11(4-2-10)16-13(19)5-6-14(20)17-8-7-12(18)9-17/h1-6,12,18H,7-9H2,(H,16,19)/b6-5+/t12-/m0/s1 |
| InChIKey | ZESFJCZMHOHAJQ-FYJFLYSWSA-N |
| XLogP | 0.91 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|